C20H20N4OS — CID 2711987
1-(4-ethylphenyl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 2711987) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-(4-ethylphenyl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 2711987 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-(4-ethylphenyl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | C=CCn1c(SCC(=O)c2ccc(CC)cc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C20H20N4OS/c1-3-13-24-19(17-9-11-21-12-10-17)22-23-20(24)26-14-18(25)16-7-5-15(4-2)6-8-16/h3,5-12H,1,4,13-14H2,2H3 |
| InChIKey | FRKLBMPDJZRKPD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|