C22H23N5OS — CID 90367042
1-(5-ethyl-2,3-dihydroindol-1-yl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 90367042) has the molecular formula C22H23N5OS and a molecular weight of 405.53 g/mol. Its IUPAC name is 1-(5-ethyl-2,3-dihydroindol-1-yl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-(5-ethyl-2,3-dihydroindol-1-yl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 90367042 |
| Molecular Formula | C22H23N5OS |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-(5-ethyl-2,3-dihydroindol-1-yl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | C=CCn1c(SCC(=O)N2CCc3cc(CC)ccc32)nnc1-c1ccncc1 |
| InChI | InChI=1S/C22H23N5OS/c1-3-12-27-21(17-7-10-23-11-8-17)24-25-22(27)29-15-20(28)26-13-9-18-14-16(4-2)5-6-19(18)26/h3,5-8,10-11,14H,1,4,9,12-13,15H2,2H3 |
| InChIKey | RYIGAGNQGZWKHX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|