C15H15BrN4S — CID 78762826
4-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile (PubChem CID 78762826) has the molecular formula C15H15BrN4S and a molecular weight of 363.28 g/mol. Its IUPAC name is 4-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile.
| Compound Name | 4-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 78762826 |
| Molecular Formula | C15H15BrN4S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 4-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile |
| SMILES | C=CCn1c(SCCCC#N)nnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H15BrN4S/c1-2-10-20-14(12-5-7-13(16)8-6-12)18-19-15(20)21-11-4-3-9-17/h2,5-8H,1,3-4,10-11H2 |
| InChIKey | BFSQNXCHAAMLTK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|