C20H20BrN3O2S — CID 17423623
1-(4-bromophenyl)-4-[[5-(3-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one (PubChem CID 17423623) has the molecular formula C20H20BrN3O2S and a molecular weight of 446.37 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-[[5-(3-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one.
| Compound Name | 1-(4-bromophenyl)-4-[[5-(3-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 17423623 |
| Molecular Formula | C20H20BrN3O2S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 1-(4-bromophenyl)-4-[[5-(3-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
| SMILES | COc1cccc(-c2nnc(SCCCC(=O)c3ccc(Br)cc3)n2C)c1 |
| InChI | InChI=1S/C20H20BrN3O2S/c1-24-19(15-5-3-6-17(13-15)26-2)22-23-20(24)27-12-4-7-18(25)14-8-10-16(21)11-9-14/h3,5-6,8-11,13H,4,7,12H2,1-2H3 |
| InChIKey | VMRUPQKBKNGETF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|