C23H28N4O3S — CID 29442777
2-[[4-cyclohexyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(3-methylphenoxy)ethyl]acetamide (PubChem CID 29442777) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-[[4-cyclohexyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(3-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-[[4-cyclohexyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(3-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 29442777 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-[[4-cyclohexyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(3-methylphenoxy)ethyl]acetamide |
| SMILES | Cc1cccc(OCCNC(=O)CSc2nnc(-c3ccco3)n2C2CCCCC2)c1 |
| InChI | InChI=1S/C23H28N4O3S/c1-17-7-5-10-19(15-17)29-14-12-24-21(28)16-31-23-26-25-22(20-11-6-13-30-20)27(23)18-8-3-2-4-9-18/h5-7,10-11,13,15,18H,2-4,8-9,12,14,16H2,1H3,(H,24,28) |
| InChIKey | MSWYXDOERNYDIV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|