C13H16ClN5O2S — CID 2575960
2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide (PubChem CID 2575960) has the molecular formula C13H16ClN5O2S and a molecular weight of 341.82 g/mol. Its IUPAC name is 2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 2575960 |
| Molecular Formula | C13H16ClN5O2S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSc1nnc(-c2cccc(Cl)c2)n1N |
| InChI | InChI=1S/C13H16ClN5O2S/c1-21-6-5-16-11(20)8-22-13-18-17-12(19(13)15)9-3-2-4-10(14)7-9/h2-4,7H,5-6,8,15H2,1H3,(H,16,20) |
| InChIKey | JNTCNZZPMHVNNN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|