C17H24ClN5OS — CID 78622632
2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-heptan-2-ylacetamide (PubChem CID 78622632) has the molecular formula C17H24ClN5OS and a molecular weight of 381.93 g/mol. Its IUPAC name is 2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-heptan-2-ylacetamide.
| Compound Name | 2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-heptan-2-ylacetamide |
|---|---|
| PubChem CID | 78622632 |
| Molecular Formula | C17H24ClN5OS |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-heptan-2-ylacetamide |
| SMILES | CCCCCC(C)NC(=O)CSc1nnc(-c2cccc(Cl)c2)n1N |
| InChI | InChI=1S/C17H24ClN5OS/c1-3-4-5-7-12(2)20-15(24)11-25-17-22-21-16(23(17)19)13-8-6-9-14(18)10-13/h6,8-10,12H,3-5,7,11,19H2,1-2H3,(H,20,24) |
| InChIKey | DIRRFWGFZITBFX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|