C18H24ClN3O2S — CID 8644351
2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(2S)-octan-2-yl]acetamide (PubChem CID 8644351) has the molecular formula C18H24ClN3O2S and a molecular weight of 381.93 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(2S)-octan-2-yl]acetamide.
| Compound Name | 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(2S)-octan-2-yl]acetamide |
|---|---|
| PubChem CID | 8644351 |
| Molecular Formula | C18H24ClN3O2S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(2S)-octan-2-yl]acetamide |
| SMILES | CCCCCC[C@H](C)NC(=O)CSc1nnc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C18H24ClN3O2S/c1-3-4-5-6-8-13(2)20-16(23)12-25-18-22-21-17(24-18)14-9-7-10-15(19)11-14/h7,9-11,13H,3-6,8,12H2,1-2H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | RNMADNVOTJLUED-ZDUSSCGKSA-N |
| XLogP | 4.96 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|