C16H19Cl2N5O3S — CID 2402008
ethyl 4-[[2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate (PubChem CID 2402008) has the molecular formula C16H19Cl2N5O3S and a molecular weight of 432.33 g/mol. Its IUPAC name is ethyl 4-[[2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 2402008 |
| Molecular Formula | C16H19Cl2N5O3S |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | ethyl 4-[[2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1nnc(-c2ccc(Cl)cc2Cl)n1N |
| InChI | InChI=1S/C16H19Cl2N5O3S/c1-2-26-14(25)4-3-7-20-13(24)9-27-16-22-21-15(23(16)19)11-6-5-10(17)8-12(11)18/h5-6,8H,2-4,7,9,19H2,1H3,(H,20,24) |
| InChIKey | LWVXRGXCTDAGGQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|