C16H11Cl4N5OS — CID 4666373
2-[[4-amino-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 4666373) has the molecular formula C16H11Cl4N5OS and a molecular weight of 463.18 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4666373 |
| Molecular Formula | C16H11Cl4N5OS |
| Molecular Weight | 463.18 g/mol |
| Exact Mass | 460.94 |
| IUPAC Name | 2-[[4-amino-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Nn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C16H11Cl4N5OS/c17-9-4-2-1-3-8(9)15-23-24-16(25(15)21)27-7-14(26)22-13-6-11(19)10(18)5-12(13)20/h1-6H,7,21H2,(H,22,26) |
| InChIKey | SYZSIWOGGCGIMO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.18 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|