C16H12Cl2N6O3S — CID 18281145
2-[[4-amino-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-4-nitrophenyl)acetamide (PubChem CID 18281145) has the molecular formula C16H12Cl2N6O3S and a molecular weight of 439.28 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-4-nitrophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 18281145 |
| Molecular Formula | C16H12Cl2N6O3S |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 2-[[4-amino-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-4-nitrophenyl)acetamide |
| SMILES | Nn1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C16H12Cl2N6O3S/c17-11-4-2-1-3-10(11)15-21-22-16(23(15)19)28-8-14(25)20-13-6-5-9(24(26)27)7-12(13)18/h1-7H,8,19H2,(H,20,25) |
| InChIKey | RPFIMWPHRRCBIL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|