C22H20BrN9O3S3 — CID 17075109
2-[[4-amino-5-[(2E)-2-[1-(1,3-benzodioxol-5-yl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17075109) has the molecular formula C22H20BrN9O3S3 and a molecular weight of 634.57 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[1-(1,3-benzodioxol-5-yl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[1-(1,3-benzodioxol-5-yl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17075109 |
| Molecular Formula | C22H20BrN9O3S3 |
| Molecular Weight | 634.57 g/mol |
| Exact Mass | 633.00 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[1-(1,3-benzodioxol-5-yl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | C/C(=N\Nc1nnc(SCC(=O)Nc2nnc(SCc3cccc(Br)c3)s2)n1N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H20BrN9O3S3/c1-12(14-5-6-16-17(8-14)35-11-34-16)26-27-19-28-30-21(32(19)24)36-10-18(33)25-20-29-31-22(38-20)37-9-13-3-2-4-15(23)7-13/h2-8H,9-11,24H2,1H3,(H,27,28)(H,25,29,33)/b26-12+ |
| InChIKey | WMAPDTYHEZJZNP-RPPGKUMJSA-N |
| XLogP | 4.19 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|