C20H17BrClN9OS3 — CID 17049943
2-[[4-amino-5-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17049943) has the molecular formula C20H17BrClN9OS3 and a molecular weight of 610.98 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17049943 |
| Molecular Formula | C20H17BrClN9OS3 |
| Molecular Weight | 610.98 g/mol |
| Exact Mass | 608.96 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Nn1c(N/N=C/c2ccc(Cl)cc2)nnc1SCC(=O)Nc1nnc(SCc2cccc(Br)c2)s1 |
| InChI | InChI=1S/C20H17BrClN9OS3/c21-14-3-1-2-13(8-14)10-34-20-30-28-18(35-20)25-16(32)11-33-19-29-27-17(31(19)23)26-24-9-12-4-6-15(22)7-5-12/h1-9H,10-11,23H2,(H,26,27)(H,25,28,32)/b24-9+ |
| InChIKey | SUXHVJCBORQKGW-PGGKNCGUSA-N |
| XLogP | 4.73 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.98 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|