C19H18ClN9O2S3 — CID 17075977
2-[[4-amino-5-[(2E)-2-[(5-methylfuran-2-yl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17075977) has the molecular formula C19H18ClN9O2S3 and a molecular weight of 536.07 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(5-methylfuran-2-yl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(5-methylfuran-2-yl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17075977 |
| Molecular Formula | C19H18ClN9O2S3 |
| Molecular Weight | 536.07 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(5-methylfuran-2-yl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Cc1ccc(/C=N/Nc2nnc(SCC(=O)Nc3nnc(SCc4ccc(Cl)cc4)s3)n2N)o1 |
| InChI | InChI=1S/C19H18ClN9O2S3/c1-11-2-7-14(31-11)8-22-24-16-25-27-18(29(16)21)32-10-15(30)23-17-26-28-19(34-17)33-9-12-3-5-13(20)6-4-12/h2-8H,9-10,21H2,1H3,(H,24,25)(H,23,26,30)/b22-8+ |
| InChIKey | GMIDBRRJNZWNJU-GZIVZEMBSA-N |
| XLogP | 3.87 |
| TPSA | 149.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.07 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|