C20H19ClN10OS3 — CID 17076687
2-[[4-amino-5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17076687) has the molecular formula C20H19ClN10OS3 and a molecular weight of 547.10 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17076687 |
| Molecular Formula | C20H19ClN10OS3 |
| Molecular Weight | 547.10 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | C/C(=N\Nc1nnc(SCC(=O)Nc2nnc(SCc3ccc(Cl)cc3)s2)n1N)c1ccccn1 |
| InChI | InChI=1S/C20H19ClN10OS3/c1-12(15-4-2-3-9-23-15)25-26-17-27-29-19(31(17)22)33-11-16(32)24-18-28-30-20(35-18)34-10-13-5-7-14(21)8-6-13/h2-9H,10-11,22H2,1H3,(H,26,27)(H,24,28,32)/b25-12+ |
| InChIKey | ZSDUJIUPOYQDOK-BRJLIKDPSA-N |
| XLogP | 3.75 |
| TPSA | 148.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.10 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|