C26H29N7OS — CID 17076435
2-[[4-amino-5-[(2E)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide (PubChem CID 17076435) has the molecular formula C26H29N7OS and a molecular weight of 487.63 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 17076435 |
| Molecular Formula | C26H29N7OS |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide |
| SMILES | CCC(C)c1ccc(NC(=O)CSc2nnc(N/N=C(\C)c3ccc4ccccc4c3)n2N)cc1 |
| InChI | InChI=1S/C26H29N7OS/c1-4-17(2)19-11-13-23(14-12-19)28-24(34)16-35-26-32-31-25(33(26)27)30-29-18(3)21-10-9-20-7-5-6-8-22(20)15-21/h5-15,17H,4,16,27H2,1-3H3,(H,28,34)(H,30,31)/b29-18+ |
| InChIKey | LKLDIDDQWJZYGZ-RDRPBHBLSA-N |
| XLogP | 5.23 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|