C22H26FN7OS — CID 17076356
2-[[4-amino-5-[(2E)-2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide (PubChem CID 17076356) has the molecular formula C22H26FN7OS and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 17076356 |
| Molecular Formula | C22H26FN7OS |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide |
| SMILES | CCC(C)c1ccc(NC(=O)CSc2nnc(N/N=C(\C)c3ccc(F)cc3)n2N)cc1 |
| InChI | InChI=1S/C22H26FN7OS/c1-4-14(2)16-7-11-19(12-8-16)25-20(31)13-32-22-29-28-21(30(22)24)27-26-15(3)17-5-9-18(23)10-6-17/h5-12,14H,4,13,24H2,1-3H3,(H,25,31)(H,27,28)/b26-15+ |
| InChIKey | JNYYIHKVIMEMAB-CVKSISIWSA-N |
| XLogP | 4.21 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|