C22H27N7O4S — CID 17074820
2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 17074820) has the molecular formula C22H27N7O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 17074820 |
| Molecular Formula | C22H27N7O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nnc(N/N=C(\C)c3ccc(OC)c(OC)c3)n2N)cc1 |
| InChI | InChI=1S/C22H27N7O4S/c1-5-33-17-9-7-16(8-10-17)24-20(30)13-34-22-28-27-21(29(22)23)26-25-14(2)15-6-11-18(31-3)19(12-15)32-4/h6-12H,5,13,23H2,1-4H3,(H,24,30)(H,26,27)/b25-14+ |
| InChIKey | GNHRBDHYLLKAFZ-AFUMVMLFSA-N |
| XLogP | 2.97 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|