C16H15Cl2N7O2S — CID 17049541
2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 17049541) has the molecular formula C16H15Cl2N7O2S and a molecular weight of 440.32 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 17049541 |
| Molecular Formula | C16H15Cl2N7O2S |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | Nn1c(N/N=C/c2ccc(Cl)cc2Cl)nnc1SCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C16H15Cl2N7O2S/c17-11-4-3-10(13(18)6-11)7-21-22-15-23-24-16(25(15)19)28-9-14(26)20-8-12-2-1-5-27-12/h1-7H,8-9,19H2,(H,20,26)(H,22,23)/b21-7+ |
| InChIKey | CQABPORQVUAHLJ-QPSGOUHRSA-N |
| XLogP | 2.75 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|