C18H18ClN7OS — CID 17049920
2-[[4-amino-5-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-benzylacetamide (PubChem CID 17049920) has the molecular formula C18H18ClN7OS and a molecular weight of 415.91 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-benzylacetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-benzylacetamide |
|---|---|
| PubChem CID | 17049920 |
| Molecular Formula | C18H18ClN7OS |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-benzylacetamide |
| SMILES | Nn1c(N/N=C/c2ccc(Cl)cc2)nnc1SCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H18ClN7OS/c19-15-8-6-14(7-9-15)11-22-23-17-24-25-18(26(17)20)28-12-16(27)21-10-13-4-2-1-3-5-13/h1-9,11H,10,12,20H2,(H,21,27)(H,23,24)/b22-11+ |
| InChIKey | JKPKOBIRNCGQKO-SSDVNMTOSA-N |
| XLogP | 2.50 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|