C23H24N8OS — CID 17049182
2-[[4-amino-5-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide (PubChem CID 17049182) has the molecular formula C23H24N8OS and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 17049182 |
| Molecular Formula | C23H24N8OS |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
| SMILES | CN(C)c1ccc(/C=N/Nc2nnc(SCC(=O)Nc3cccc4ccccc34)n2N)cc1 |
| InChI | InChI=1S/C23H24N8OS/c1-30(2)18-12-10-16(11-13-18)14-25-27-22-28-29-23(31(22)24)33-15-21(32)26-20-9-5-7-17-6-3-4-8-19(17)20/h3-14H,15,24H2,1-2H3,(H,26,32)(H,27,28)/b25-14+ |
| InChIKey | UECWTFVWMWPIDG-AFUMVMLFSA-N |
| XLogP | 3.39 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|