C22H28N8O2S — CID 17049258
2-[[4-amino-5-[(2E)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 17049258) has the molecular formula C22H28N8O2S and a molecular weight of 468.59 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 17049258 |
| Molecular Formula | C22H28N8O2S |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=N/Nc2nnc(SCC(=O)Nc3ccc(OC)cc3)n2N)cc1 |
| InChI | InChI=1S/C22H28N8O2S/c1-4-29(5-2)18-10-6-16(7-11-18)14-24-26-21-27-28-22(30(21)23)33-15-20(31)25-17-8-12-19(32-3)13-9-17/h6-14H,4-5,15,23H2,1-3H3,(H,25,31)(H,26,27)/b24-14+ |
| InChIKey | GWUTYPIRVJMOQL-ZVHZXABRSA-N |
| XLogP | 3.02 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|