C21H24N8O2S — CID 17049229
N-(4-acetylphenyl)-2-[[4-amino-5-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17049229) has the molecular formula C21H24N8O2S and a molecular weight of 452.54 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[[4-amino-5-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[[4-amino-5-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17049229 |
| Molecular Formula | C21H24N8O2S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-(4-acetylphenyl)-2-[[4-amino-5-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)CSc2nnc(N/N=C/c3ccc(N(C)C)cc3)n2N)cc1 |
| InChI | InChI=1S/C21H24N8O2S/c1-14(30)16-6-8-17(9-7-16)24-19(31)13-32-21-27-26-20(29(21)22)25-23-12-15-4-10-18(11-5-15)28(2)3/h4-12H,13,22H2,1-3H3,(H,24,31)(H,25,26)/b23-12+ |
| InChIKey | JHIMYZNAFHKFRC-FSJBWODESA-N |
| XLogP | 2.44 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|