C12H15N7O2S — CID 17344870
N-(4-acetylphenyl)-2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 17344870) has the molecular formula C12H15N7O2S and a molecular weight of 321.37 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 17344870 |
| Molecular Formula | C12H15N7O2S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-(4-acetylphenyl)-2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)CSc2nnc(NN)n2N)cc1 |
| InChI | InChI=1S/C12H15N7O2S/c1-7(20)8-2-4-9(5-3-8)15-10(21)6-22-12-18-17-11(16-13)19(12)14/h2-5H,6,13-14H2,1H3,(H,15,21)(H,16,17) |
| InChIKey | ARXKOFBGWTZMKR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|