C13H17N7OS — CID 17076171
2-[[4-amino-5-[(2E)-2-(1-phenylpropylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17076171) has the molecular formula C13H17N7OS and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(1-phenylpropylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(1-phenylpropylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17076171 |
| Molecular Formula | C13H17N7OS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(1-phenylpropylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC/C(=N\Nc1nnc(SCC(N)=O)n1N)c1ccccc1 |
| InChI | InChI=1S/C13H17N7OS/c1-2-10(9-6-4-3-5-7-9)16-17-12-18-19-13(20(12)15)22-8-11(14)21/h3-7H,2,8,15H2,1H3,(H2,14,21)(H,17,18)/b16-10+ |
| InChIKey | SZAZFEIFUOQHIV-MHWRWJLKSA-N |
| XLogP | 0.80 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|