C10H14N6S — CID 17344814
3-hydrazinyl-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 17344814) has the molecular formula C10H14N6S and a molecular weight of 250.33 g/mol. Its IUPAC name is 3-hydrazinyl-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-hydrazinyl-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 17344814 |
| Molecular Formula | C10H14N6S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-hydrazinyl-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Cc1cccc(CSc2nnc(NN)n2N)c1 |
| InChI | InChI=1S/C10H14N6S/c1-7-3-2-4-8(5-7)6-17-10-15-14-9(13-11)16(10)12/h2-5H,6,11-12H2,1H3,(H,13,14) |
| InChIKey | VOYPMFCTWCKKOY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|