C17H18BrN7OS2 — CID 17344875
2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-[(3-bromophenyl)methylsulfanyl]phenyl]acetamide (PubChem CID 17344875) has the molecular formula C17H18BrN7OS2 and a molecular weight of 480.42 g/mol. Its IUPAC name is 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-[(3-bromophenyl)methylsulfanyl]phenyl]acetamide.
| Compound Name | 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-[(3-bromophenyl)methylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 17344875 |
| Molecular Formula | C17H18BrN7OS2 |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-[(3-bromophenyl)methylsulfanyl]phenyl]acetamide |
| SMILES | NNc1nnc(SCC(=O)Nc2ccccc2SCc2cccc(Br)c2)n1N |
| InChI | InChI=1S/C17H18BrN7OS2/c18-12-5-3-4-11(8-12)9-27-14-7-2-1-6-13(14)21-15(26)10-28-17-24-23-16(22-19)25(17)20/h1-8H,9-10,19-20H2,(H,21,26)(H,22,23) |
| InChIKey | WBKNFTVPKPVKQH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|