C23H23N7O2S — CID 17076954
2-[[4-amino-5-[(2E)-2-[1-(3-methoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide (PubChem CID 17076954) has the molecular formula C23H23N7O2S and a molecular weight of 461.55 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[1-(3-methoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[1-(3-methoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 17076954 |
| Molecular Formula | C23H23N7O2S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[1-(3-methoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
| SMILES | COc1cccc(/C(C)=N/Nc2nnc(SCC(=O)Nc3cccc4ccccc34)n2N)c1 |
| InChI | InChI=1S/C23H23N7O2S/c1-15(17-9-5-10-18(13-17)32-2)26-27-22-28-29-23(30(22)24)33-14-21(31)25-20-12-6-8-16-7-3-4-11-19(16)20/h3-13H,14,24H2,1-2H3,(H,25,31)(H,27,28)/b26-15+ |
| InChIKey | UAFJURCEHDVJFD-CVKSISIWSA-N |
| XLogP | 3.72 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|