C20H16ClN3O2S — CID 91964516
2-(3-chlorothiophen-2-yl)-N-(2,5-dimethoxyphenyl)quinazolin-4-amine (PubChem CID 91964516) has the molecular formula C20H16ClN3O2S and a molecular weight of 397.89 g/mol. Its IUPAC name is 2-(3-chlorothiophen-2-yl)-N-(2,5-dimethoxyphenyl)quinazolin-4-amine.
| Compound Name | 2-(3-chlorothiophen-2-yl)-N-(2,5-dimethoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 91964516 |
| Molecular Formula | C20H16ClN3O2S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 2-(3-chlorothiophen-2-yl)-N-(2,5-dimethoxyphenyl)quinazolin-4-amine |
| SMILES | COc1ccc(OC)c(Nc2nc(-c3sccc3Cl)nc3ccccc23)c1 |
| InChI | InChI=1S/C20H16ClN3O2S/c1-25-12-7-8-17(26-2)16(11-12)23-19-13-5-3-4-6-15(13)22-20(24-19)18-14(21)9-10-27-18/h3-11H,1-2H3,(H,22,23,24) |
| InChIKey | LLVMEQVZLJNQJY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |