C18H14ClN3S2 — CID 91964585
2-(3-chlorothiophen-2-yl)-N-(2-thiophen-2-ylethyl)quinazolin-4-amine (PubChem CID 91964585) has the molecular formula C18H14ClN3S2 and a molecular weight of 371.92 g/mol. Its IUPAC name is 2-(3-chlorothiophen-2-yl)-N-(2-thiophen-2-ylethyl)quinazolin-4-amine.
| Compound Name | 2-(3-chlorothiophen-2-yl)-N-(2-thiophen-2-ylethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 91964585 |
| Molecular Formula | C18H14ClN3S2 |
| Molecular Weight | 371.92 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 2-(3-chlorothiophen-2-yl)-N-(2-thiophen-2-ylethyl)quinazolin-4-amine |
| SMILES | Clc1ccsc1-c1nc(NCCc2cccs2)c2ccccc2n1 |
| InChI | InChI=1S/C18H14ClN3S2/c19-14-8-11-24-16(14)18-21-15-6-2-1-5-13(15)17(22-18)20-9-7-12-4-3-10-23-12/h1-6,8,10-11H,7,9H2,(H,20,21,22) |
| InChIKey | SPURGLVYPGZRJN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.92 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |