C21H16F3N3S — CID 166632975
N-(2-thiophen-2-ylethyl)-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine (PubChem CID 166632975) has the molecular formula C21H16F3N3S and a molecular weight of 399.44 g/mol. Its IUPAC name is N-(2-thiophen-2-ylethyl)-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine.
| Compound Name | N-(2-thiophen-2-ylethyl)-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 166632975 |
| Molecular Formula | C21H16F3N3S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N-(2-thiophen-2-ylethyl)-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine |
| SMILES | FC(F)(F)c1ccccc1-c1nc(NCCc2cccs2)c2ccccc2n1 |
| InChI | InChI=1S/C21H16F3N3S/c22-21(23,24)17-9-3-1-7-15(17)20-26-18-10-4-2-8-16(18)19(27-20)25-12-11-14-6-5-13-28-14/h1-10,13H,11-12H2,(H,25,26,27) |
| InChIKey | JSNWXNPFECSHNH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |