C12H10BrF3N2S — CID 106795936
5-bromo-N-(2-thiophen-2-ylethyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106795936) has the molecular formula C12H10BrF3N2S and a molecular weight of 351.19 g/mol. Its IUPAC name is 5-bromo-N-(2-thiophen-2-ylethyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(2-thiophen-2-ylethyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106795936 |
| Molecular Formula | C12H10BrF3N2S |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 5-bromo-N-(2-thiophen-2-ylethyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cc(Br)cnc1NCCc1cccs1 |
| InChI | InChI=1S/C12H10BrF3N2S/c13-8-6-10(12(14,15)16)11(18-7-8)17-4-3-9-2-1-5-19-9/h1-2,5-7H,3-4H2,(H,17,18) |
| InChIKey | IEJXWYPJHRCQKB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |