C18H13ClN4S — CID 91964577
2-(3-chlorothiophen-2-yl)-N-(pyridin-3-ylmethyl)quinazolin-4-amine (PubChem CID 91964577) has the molecular formula C18H13ClN4S and a molecular weight of 352.85 g/mol. Its IUPAC name is 2-(3-chlorothiophen-2-yl)-N-(pyridin-3-ylmethyl)quinazolin-4-amine.
| Compound Name | 2-(3-chlorothiophen-2-yl)-N-(pyridin-3-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 91964577 |
| Molecular Formula | C18H13ClN4S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-(3-chlorothiophen-2-yl)-N-(pyridin-3-ylmethyl)quinazolin-4-amine |
| SMILES | Clc1ccsc1-c1nc(NCc2cccnc2)c2ccccc2n1 |
| InChI | InChI=1S/C18H13ClN4S/c19-14-7-9-24-16(14)18-22-15-6-2-1-5-13(15)17(23-18)21-11-12-4-3-8-20-10-12/h1-10H,11H2,(H,21,22,23) |
| InChIKey | MHRYQJLMONWGCJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |