C16H13N3O — CID 139772534
4-(4-ethoxyanilino)benzene-1,2-dicarbonitrile (PubChem CID 139772534) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-(4-ethoxyanilino)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(4-ethoxyanilino)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139772534 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4-(4-ethoxyanilino)benzene-1,2-dicarbonitrile |
| SMILES | CCOc1ccc(Nc2ccc(C#N)c(C#N)c2)cc1 |
| InChI | InChI=1S/C16H13N3O/c1-2-20-16-7-5-14(6-8-16)19-15-4-3-12(10-17)13(9-15)11-18/h3-9,19H,2H2,1H3 |
| InChIKey | FWRFEXZZTXFEMP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |