C12H12BrN3 — CID 106750334
4-N-(3-bromophenyl)benzene-1,2,4-triamine (PubChem CID 106750334) has the molecular formula C12H12BrN3 and a molecular weight of 278.15 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)benzene-1,2,4-triamine.
| Compound Name | 4-N-(3-bromophenyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106750334 |
| Molecular Formula | C12H12BrN3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 4-N-(3-bromophenyl)benzene-1,2,4-triamine |
| SMILES | Nc1ccc(Nc2cccc(Br)c2)cc1N |
| InChI | InChI=1S/C12H12BrN3/c13-8-2-1-3-9(6-8)16-10-4-5-11(14)12(15)7-10/h1-7,16H,14-15H2 |
| InChIKey | JEQBBMFPBDQELE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|