C12H10BrIN2 — CID 66094560
1-N-(3-bromophenyl)-2-iodobenzene-1,4-diamine (PubChem CID 66094560) has the molecular formula C12H10BrIN2 and a molecular weight of 389.03 g/mol. Its IUPAC name is 1-N-(3-bromophenyl)-2-iodobenzene-1,4-diamine.
| Compound Name | 1-N-(3-bromophenyl)-2-iodobenzene-1,4-diamine |
|---|---|
| PubChem CID | 66094560 |
| Molecular Formula | C12H10BrIN2 |
| Molecular Weight | 389.03 g/mol |
| Exact Mass | 387.91 |
| IUPAC Name | 1-N-(3-bromophenyl)-2-iodobenzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2cccc(Br)c2)c(I)c1 |
| InChI | InChI=1S/C12H10BrIN2/c13-8-2-1-3-10(6-8)16-12-5-4-9(15)7-11(12)14/h1-7,16H,15H2 |
| InChIKey | CMCJXFWRVNBYCB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.03 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|