C15H12BrN3 — CID 43450961
2-N-(3-bromophenyl)quinoline-2,6-diamine (PubChem CID 43450961) has the molecular formula C15H12BrN3 and a molecular weight of 314.19 g/mol. Its IUPAC name is 2-N-(3-bromophenyl)quinoline-2,6-diamine.
| Compound Name | 2-N-(3-bromophenyl)quinoline-2,6-diamine |
|---|---|
| PubChem CID | 43450961 |
| Molecular Formula | C15H12BrN3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 2-N-(3-bromophenyl)quinoline-2,6-diamine |
| SMILES | Nc1ccc2nc(Nc3cccc(Br)c3)ccc2c1 |
| InChI | InChI=1S/C15H12BrN3/c16-11-2-1-3-13(9-11)18-15-7-4-10-8-12(17)5-6-14(10)19-15/h1-9H,17H2,(H,18,19) |
| InChIKey | AODVRLOPJZAPQH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|