C16H18BrCl2N5 — CID 118386833
2-(2-aminoethyl)-4-N-(3-bromophenyl)quinazoline-4,6-diamine;dihydrochloride (PubChem CID 118386833) has the molecular formula C16H18BrCl2N5 and a molecular weight of 431.17 g/mol. Its IUPAC name is 2-(2-aminoethyl)-4-N-(3-bromophenyl)quinazoline-4,6-diamine;dihydrochloride.
| Compound Name | 2-(2-aminoethyl)-4-N-(3-bromophenyl)quinazoline-4,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 118386833 |
| Molecular Formula | C16H18BrCl2N5 |
| Molecular Weight | 431.17 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 2-(2-aminoethyl)-4-N-(3-bromophenyl)quinazoline-4,6-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCCc1nc(Nc2cccc(Br)c2)c2cc(N)ccc2n1 |
| InChI | InChI=1S/C16H16BrN5.2ClH/c17-10-2-1-3-12(8-10)20-16-13-9-11(19)4-5-14(13)21-15(22-16)6-7-18;;/h1-5,8-9H,6-7,18-19H2,(H,20,21,22);2*1H |
| InChIKey | GQUZUIQNZHOXPG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.17 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|