C22H26FIN4O4 — CID 91363838
2-[2-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]ethoxy]-4-N-(3-iodophenyl)quinazoline-4,6-diamine (PubChem CID 91363838) has the molecular formula C22H26FIN4O4 and a molecular weight of 556.38 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]ethoxy]-4-N-(3-iodophenyl)quinazoline-4,6-diamine.
| Compound Name | 2-[2-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]ethoxy]-4-N-(3-iodophenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 91363838 |
| Molecular Formula | C22H26FIN4O4 |
| Molecular Weight | 556.38 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | 2-[2-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]ethoxy]-4-N-(3-iodophenyl)quinazoline-4,6-diamine |
| SMILES | Nc1ccc2nc(OCCOCCOCCOCCF)nc(Nc3cccc(I)c3)c2c1 |
| InChI | InChI=1S/C22H26FIN4O4/c23-6-7-29-8-9-30-10-11-31-12-13-32-22-27-20-5-4-17(25)15-19(20)21(28-22)26-18-3-1-2-16(24)14-18/h1-5,14-15H,6-13,25H2,(H,26,27,28) |
| InChIKey | OTGUCEFBULARPV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|