C22H18BrN5O — CID 87658081
N-[4-[2-amino-4-(3-bromoanilino)quinazolin-6-yl]phenyl]-N-methylformamide (PubChem CID 87658081) has the molecular formula C22H18BrN5O and a molecular weight of 448.32 g/mol. Its IUPAC name is N-[4-[2-amino-4-(3-bromoanilino)quinazolin-6-yl]phenyl]-N-methylformamide.
| Compound Name | N-[4-[2-amino-4-(3-bromoanilino)quinazolin-6-yl]phenyl]-N-methylformamide |
|---|---|
| PubChem CID | 87658081 |
| Molecular Formula | C22H18BrN5O |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[4-[2-amino-4-(3-bromoanilino)quinazolin-6-yl]phenyl]-N-methylformamide |
| SMILES | CN(C=O)c1ccc(-c2ccc3nc(N)nc(Nc4cccc(Br)c4)c3c2)cc1 |
| InChI | InChI=1S/C22H18BrN5O/c1-28(13-29)18-8-5-14(6-9-18)15-7-10-20-19(11-15)21(27-22(24)26-20)25-17-4-2-3-16(23)12-17/h2-13H,1H3,(H3,24,25,26,27) |
| InChIKey | NJHOBBRCWGIORN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|