C25H24BrN5O — CID 69017846
3-[2-amino-4-(3-bromoanilino)quinazolin-6-yl]-N,N-diethylbenzamide (PubChem CID 69017846) has the molecular formula C25H24BrN5O and a molecular weight of 490.41 g/mol. Its IUPAC name is 3-[2-amino-4-(3-bromoanilino)quinazolin-6-yl]-N,N-diethylbenzamide.
| Compound Name | 3-[2-amino-4-(3-bromoanilino)quinazolin-6-yl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 69017846 |
| Molecular Formula | C25H24BrN5O |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 3-[2-amino-4-(3-bromoanilino)quinazolin-6-yl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(-c2ccc3nc(N)nc(Nc4cccc(Br)c4)c3c2)c1 |
| InChI | InChI=1S/C25H24BrN5O/c1-3-31(4-2)24(32)18-8-5-7-16(13-18)17-11-12-22-21(14-17)23(30-25(27)29-22)28-20-10-6-9-19(26)15-20/h5-15H,3-4H2,1-2H3,(H3,27,28,29,30) |
| InChIKey | DFHJUBSJTSLPTA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |