C24H25BrN6O — CID 69013791
4-N-(3-bromophenyl)-6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]quinazoline-2,4-diamine (PubChem CID 69013791) has the molecular formula C24H25BrN6O and a molecular weight of 493.41 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]quinazoline-2,4-diamine.
| Compound Name | 4-N-(3-bromophenyl)-6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 69013791 |
| Molecular Formula | C24H25BrN6O |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 4-N-(3-bromophenyl)-6-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]quinazoline-2,4-diamine |
| SMILES | CN(C)CCCOc1ccc(-c2ccc3nc(N)nc(Nc4cccc(Br)c4)c3c2)cn1 |
| InChI | InChI=1S/C24H25BrN6O/c1-31(2)11-4-12-32-22-10-8-17(15-27-22)16-7-9-21-20(13-16)23(30-24(26)29-21)28-19-6-3-5-18(25)14-19/h3,5-10,13-15H,4,11-12H2,1-2H3,(H3,26,28,29,30) |
| InChIKey | NANGANUTLFQITH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|