C21H18BrN5 — CID 69013442
6-(2-amino-5-methylphenyl)-4-N-(3-bromophenyl)quinazoline-2,4-diamine (PubChem CID 69013442) has the molecular formula C21H18BrN5 and a molecular weight of 420.31 g/mol. Its IUPAC name is 6-(2-amino-5-methylphenyl)-4-N-(3-bromophenyl)quinazoline-2,4-diamine.
| Compound Name | 6-(2-amino-5-methylphenyl)-4-N-(3-bromophenyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 69013442 |
| Molecular Formula | C21H18BrN5 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 6-(2-amino-5-methylphenyl)-4-N-(3-bromophenyl)quinazoline-2,4-diamine |
| SMILES | Cc1ccc(N)c(-c2ccc3nc(N)nc(Nc4cccc(Br)c4)c3c2)c1 |
| InChI | InChI=1S/C21H18BrN5/c1-12-5-7-18(23)16(9-12)13-6-8-19-17(10-13)20(27-21(24)26-19)25-15-4-2-3-14(22)11-15/h2-11H,23H2,1H3,(H3,24,25,26,27) |
| InChIKey | IGRULYRNSATEAB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|