C15H11Cl2N3 — CID 43450981
2-N-(2,3-dichlorophenyl)quinoline-2,6-diamine (PubChem CID 43450981) has the molecular formula C15H11Cl2N3 and a molecular weight of 304.18 g/mol. Its IUPAC name is 2-N-(2,3-dichlorophenyl)quinoline-2,6-diamine.
| Compound Name | 2-N-(2,3-dichlorophenyl)quinoline-2,6-diamine |
|---|---|
| PubChem CID | 43450981 |
| Molecular Formula | C15H11Cl2N3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-N-(2,3-dichlorophenyl)quinoline-2,6-diamine |
| SMILES | Nc1ccc2nc(Nc3cccc(Cl)c3Cl)ccc2c1 |
| InChI | InChI=1S/C15H11Cl2N3/c16-11-2-1-3-13(15(11)17)20-14-7-4-9-8-10(18)5-6-12(9)19-14/h1-8H,18H2,(H,19,20) |
| InChIKey | BXNSMNIUOAWLSK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|