C41H56FN3O2 — CID 67930479
N,N-didecyl-4-[2-[6-[2-(3-fluoro-4-nitrophenyl)ethenyl]-3-pyridinyl]ethenyl]aniline (PubChem CID 67930479) has the molecular formula C41H56FN3O2 and a molecular weight of 641.92 g/mol. Its IUPAC name is N,N-didecyl-4-[2-[6-[2-(3-fluoro-4-nitrophenyl)ethenyl]-3-pyridinyl]ethenyl]aniline.
| Compound Name | N,N-didecyl-4-[2-[6-[2-(3-fluoro-4-nitrophenyl)ethenyl]-3-pyridinyl]ethenyl]aniline |
|---|---|
| PubChem CID | 67930479 |
| Molecular Formula | C41H56FN3O2 |
| Molecular Weight | 641.92 g/mol |
| Exact Mass | 641.44 |
| IUPAC Name | N,N-didecyl-4-[2-[6-[2-(3-fluoro-4-nitrophenyl)ethenyl]-3-pyridinyl]ethenyl]aniline |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)c1ccc(C=Cc2ccc(C=Cc3ccc([N+](=O)[O-])c(F)c3)nc2)cc1 |
| InChI | InChI=1S/C41H56FN3O2/c1-3-5-7-9-11-13-15-17-31-44(32-18-16-14-12-10-8-6-4-2)39-28-23-35(24-29-39)19-20-37-22-27-38(43-34-37)26-21-36-25-30-41(45(46)47)40(42)33-36/h19-30,33-34H,3-18,31-32H2,1-2H3 |
| InChIKey | CTDMXXHQCDHYFQ-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.92 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|