C30H44N4O4 — CID 88517510
1-N,1-N,2-N,2-N-tetrabutyl-4-[2-(3,4-dinitrophenyl)ethenyl]benzene-1,2-diamine (PubChem CID 88517510) has the molecular formula C30H44N4O4 and a molecular weight of 524.71 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N-tetrabutyl-4-[2-(3,4-dinitrophenyl)ethenyl]benzene-1,2-diamine.
| Compound Name | 1-N,1-N,2-N,2-N-tetrabutyl-4-[2-(3,4-dinitrophenyl)ethenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 88517510 |
| Molecular Formula | C30H44N4O4 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | 1-N,1-N,2-N,2-N-tetrabutyl-4-[2-(3,4-dinitrophenyl)ethenyl]benzene-1,2-diamine |
| SMILES | CCCCN(CCCC)c1ccc(C=Cc2ccc([N+](=O)[O-])c([N+](=O)[O-])c2)cc1N(CCCC)CCCC |
| InChI | InChI=1S/C30H44N4O4/c1-5-9-19-31(20-10-6-2)27-17-15-25(23-29(27)32(21-11-7-3)22-12-8-4)13-14-26-16-18-28(33(35)36)30(24-26)34(37)38/h13-18,23-24H,5-12,19-22H2,1-4H3 |
| InChIKey | ZXTZVVAZDOMSDD-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|