C21H25N3O4 — CID 88517520
4-[2-(3,4-dinitrophenyl)ethenyl]-N-heptylaniline (PubChem CID 88517520) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[2-(3,4-dinitrophenyl)ethenyl]-N-heptylaniline.
| Compound Name | 4-[2-(3,4-dinitrophenyl)ethenyl]-N-heptylaniline |
|---|---|
| PubChem CID | 88517520 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 4-[2-(3,4-dinitrophenyl)ethenyl]-N-heptylaniline |
| SMILES | CCCCCCCNc1ccc(C=Cc2ccc([N+](=O)[O-])c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-2-3-4-5-6-15-22-19-12-9-17(10-13-19)7-8-18-11-14-20(23(25)26)21(16-18)24(27)28/h7-14,16,22H,2-6,15H2,1H3 |
| InChIKey | IMRVTZNWYPCQSA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|