C42H56N4O2 — CID 67930637
5-[(E)-2-[5-[(E)-2-[4-(didecylamino)phenyl]ethenyl]-2-pyridinyl]ethenyl]-2-nitrobenzonitrile (PubChem CID 67930637) has the molecular formula C42H56N4O2 and a molecular weight of 648.94 g/mol. Its IUPAC name is 5-[(E)-2-[5-[(E)-2-[4-(didecylamino)phenyl]ethenyl]-2-pyridinyl]ethenyl]-2-nitrobenzonitrile.
| Compound Name | 5-[(E)-2-[5-[(E)-2-[4-(didecylamino)phenyl]ethenyl]-2-pyridinyl]ethenyl]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 67930637 |
| Molecular Formula | C42H56N4O2 |
| Molecular Weight | 648.94 g/mol |
| Exact Mass | 648.44 |
| IUPAC Name | 5-[(E)-2-[5-[(E)-2-[4-(didecylamino)phenyl]ethenyl]-2-pyridinyl]ethenyl]-2-nitrobenzonitrile |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)c1ccc(/C=C/c2ccc(/C=C/c3ccc([N+](=O)[O-])c(C#N)c3)nc2)cc1 |
| InChI | InChI=1S/C42H56N4O2/c1-3-5-7-9-11-13-15-17-31-45(32-18-16-14-12-10-8-6-4-2)41-28-23-36(24-29-41)19-20-38-22-27-40(44-35-38)26-21-37-25-30-42(46(47)48)39(33-37)34-43/h19-30,33,35H,3-18,31-32H2,1-2H3/b20-19+,26-21+ |
| InChIKey | BAPHMKILLANKHJ-ONMKWXJGSA-N |
| XLogP | 12.29 |
| TPSA | 83.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.94 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|