C22H26N4O8S — CID 101277742
ethyl 2-[[4-[bis(3-methoxy-3-oxopropyl)amino]-2-methylphenyl]diazenyl]-5-nitrothiophene-3-carboxylate (PubChem CID 101277742) has the molecular formula C22H26N4O8S and a molecular weight of 506.54 g/mol. Its IUPAC name is ethyl 2-[[4-[bis(3-methoxy-3-oxopropyl)amino]-2-methylphenyl]diazenyl]-5-nitrothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-[bis(3-methoxy-3-oxopropyl)amino]-2-methylphenyl]diazenyl]-5-nitrothiophene-3-carboxylate |
|---|---|
| PubChem CID | 101277742 |
| Molecular Formula | C22H26N4O8S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | ethyl 2-[[4-[bis(3-methoxy-3-oxopropyl)amino]-2-methylphenyl]diazenyl]-5-nitrothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])sc1/N=N/c1ccc(N(CCC(=O)OC)CCC(=O)OC)cc1C |
| InChI | InChI=1S/C22H26N4O8S/c1-5-34-22(29)16-13-18(26(30)31)35-21(16)24-23-17-7-6-15(12-14(17)2)25(10-8-19(27)32-3)11-9-20(28)33-4/h6-7,12-13H,5,8-11H2,1-4H3/b24-23+ |
| InChIKey | JKKNQOFPIJMFDI-WCWDXBQESA-N |
| XLogP | 4.49 |
| TPSA | 150.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|