About methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline
methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline (PubChem CID 161177760) has the molecular formula C17H20N4O6
and a molecular weight of 376.37 g/mol. Its IUPAC name is methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline.
Molecular Properties
| Compound Name | methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline |
| PubChem CID | 161177760 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline |
| SMILES | COC(=O)CCN(C)c1ccc([N+](=O)[O-])cc1.Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H14N2O4.C6H6N2O2/c1-12(8-7-11(14)17-2)9-3-5-10(6-4-9)13(15)16;7-5-1-3-6(4-2-5)8(9)10/h3-6H,7-8H2,1-2H3;1-4H,7H2 |
| InChIKey | USAROYAOSBYVMW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline?
The IUPAC name of methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline (CID 161177760) is methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline.
What is the SMILES notation for methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline?
The canonical SMILES for methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline is COC(=O)CCN(C)c1ccc([N+](=O)[O-])cc1.Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline?
The InChIKey is USAROYAOSBYVMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4.C6H6N2O2/c1-12(8-7-11(14)17-2)9-3-5-10(6-4-9)13(15)16;7-5-1-3-6(4-2-5)8(9)10/h3-6H,7-8H2,1-2H3;1-4H,7H2.
What are the key properties of methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline?
methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline has a molecular weight of 376.37 g/mol, XLogP of 2.77, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(N-methyl-4-nitroanilino)propanoate;4-nitroaniline is sourced from PubChem (CID 161177760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).